C11H13N3O4S — CID 78982828
5-oxo-N-(4-sulfamoylphenyl)pyrrolidine-3-carboxamide (PubChem CID 78982828) has the molecular formula C11H13N3O4S and a molecular weight of 283.31 g/mol. Its IUPAC name is 5-oxo-N-(4-sulfamoylphenyl)pyrrolidine-3-carboxamide.
| Compound Name | 5-oxo-N-(4-sulfamoylphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 78982828 |
| Molecular Formula | C11H13N3O4S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 5-oxo-N-(4-sulfamoylphenyl)pyrrolidine-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C2CNC(=O)C2)cc1 |
| InChI | InChI=1S/C11H13N3O4S/c12-19(17,18)9-3-1-8(2-4-9)14-11(16)7-5-10(15)13-6-7/h1-4,7H,5-6H2,(H,13,15)(H,14,16)(H2,12,17,18) |
| InChIKey | ACXCCNIRANJHLM-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |