C12H12F2N2O4S — CID 78982469
N-[4-(difluoromethylsulfonyl)phenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 78982469) has the molecular formula C12H12F2N2O4S and a molecular weight of 318.30 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfonyl)phenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[4-(difluoromethylsulfonyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 78982469 |
| Molecular Formula | C12H12F2N2O4S |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | N-[4-(difluoromethylsulfonyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C1CC(C(=O)Nc2ccc(S(=O)(=O)C(F)F)cc2)CN1 |
| InChI | InChI=1S/C12H12F2N2O4S/c13-12(14)21(19,20)9-3-1-8(2-4-9)16-11(18)7-5-10(17)15-6-7/h1-4,7,12H,5-6H2,(H,15,17)(H,16,18) |
| InChIKey | FVXGEWBIWHCZET-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |