C13H15F2NO4S — CID 31972791
N-[4-(difluoromethylsulfonyl)phenyl]oxane-4-carboxamide (PubChem CID 31972791) has the molecular formula C13H15F2NO4S and a molecular weight of 319.33 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfonyl)phenyl]oxane-4-carboxamide.
| Compound Name | N-[4-(difluoromethylsulfonyl)phenyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 31972791 |
| Molecular Formula | C13H15F2NO4S |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | N-[4-(difluoromethylsulfonyl)phenyl]oxane-4-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)C(F)F)cc1)C1CCOCC1 |
| InChI | InChI=1S/C13H15F2NO4S/c14-13(15)21(18,19)11-3-1-10(2-4-11)16-12(17)9-5-7-20-8-6-9/h1-4,9,13H,5-8H2,(H,16,17) |
| InChIKey | NHDGJMQGXOKCPN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |