C13H17F2NO3S — CID 62350308
4-(difluoromethylsulfonyl)-N-(oxan-4-ylmethyl)aniline (PubChem CID 62350308) has the molecular formula C13H17F2NO3S and a molecular weight of 305.35 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-(oxan-4-ylmethyl)aniline.
| Compound Name | 4-(difluoromethylsulfonyl)-N-(oxan-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 62350308 |
| Molecular Formula | C13H17F2NO3S |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-(oxan-4-ylmethyl)aniline |
| SMILES | O=S(=O)(c1ccc(NCC2CCOCC2)cc1)C(F)F |
| InChI | InChI=1S/C13H17F2NO3S/c14-13(15)20(17,18)12-3-1-11(2-4-12)16-9-10-5-7-19-8-6-10/h1-4,10,13,16H,5-9H2 |
| InChIKey | XOQAEELSUHDNFD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |