C12H15F2NO2S3 — CID 115685302
4-(difluoromethylsulfonyl)-N-(1,4-dithian-2-ylmethyl)aniline (PubChem CID 115685302) has the molecular formula C12H15F2NO2S3 and a molecular weight of 339.45 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-(1,4-dithian-2-ylmethyl)aniline.
| Compound Name | 4-(difluoromethylsulfonyl)-N-(1,4-dithian-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 115685302 |
| Molecular Formula | C12H15F2NO2S3 |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-(1,4-dithian-2-ylmethyl)aniline |
| SMILES | O=S(=O)(c1ccc(NCC2CSCCS2)cc1)C(F)F |
| InChI | InChI=1S/C12H15F2NO2S3/c13-12(14)20(16,17)11-3-1-9(2-4-11)15-7-10-8-18-5-6-19-10/h1-4,10,12,15H,5-8H2 |
| InChIKey | RKAMUQCDIPCYPQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |