C12H16N2O2S2 — CID 113489464
N-(1,4-dithian-2-ylmethyl)-3-methyl-5-nitroaniline (PubChem CID 113489464) has the molecular formula C12H16N2O2S2 and a molecular weight of 284.41 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-3-methyl-5-nitroaniline.
| Compound Name | N-(1,4-dithian-2-ylmethyl)-3-methyl-5-nitroaniline |
|---|---|
| PubChem CID | 113489464 |
| Molecular Formula | C12H16N2O2S2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-3-methyl-5-nitroaniline |
| SMILES | Cc1cc(NCC2CSCCS2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H16N2O2S2/c1-9-4-10(6-11(5-9)14(15)16)13-7-12-8-17-2-3-18-12/h4-6,12-13H,2-3,7-8H2,1H3 |
| InChIKey | RIJLQFNGYZBWBB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|