C14H22N4O2 — CID 115981375
N-[(1,4-dimethylpiperazin-2-yl)methyl]-3-methyl-5-nitroaniline (PubChem CID 115981375) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperazin-2-yl)methyl]-3-methyl-5-nitroaniline.
| Compound Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]-3-methyl-5-nitroaniline |
|---|---|
| PubChem CID | 115981375 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]-3-methyl-5-nitroaniline |
| SMILES | Cc1cc(NCC2CN(C)CCN2C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H22N4O2/c1-11-6-12(8-13(7-11)18(19)20)15-9-14-10-16(2)4-5-17(14)3/h6-8,14-15H,4-5,9-10H2,1-3H3 |
| InChIKey | BYKFWXLWGXMORR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 61.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|