C13H19FN4O2 — CID 63896548
N-[(1,4-dimethylpiperazin-2-yl)methyl]-5-fluoro-2-nitroaniline (PubChem CID 63896548) has the molecular formula C13H19FN4O2 and a molecular weight of 282.32 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperazin-2-yl)methyl]-5-fluoro-2-nitroaniline.
| Compound Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]-5-fluoro-2-nitroaniline |
|---|---|
| PubChem CID | 63896548 |
| Molecular Formula | C13H19FN4O2 |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]-5-fluoro-2-nitroaniline |
| SMILES | CN1CCN(C)C(CNc2cc(F)ccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C13H19FN4O2/c1-16-5-6-17(2)11(9-16)8-15-12-7-10(14)3-4-13(12)18(19)20/h3-4,7,11,15H,5-6,8-9H2,1-2H3 |
| InChIKey | CFHBJASZXOCGKV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 61.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|