C11H14FN3O2 — CID 62665396
N-cyclopropyl-N'-(5-fluoro-2-nitrophenyl)ethane-1,2-diamine (PubChem CID 62665396) has the molecular formula C11H14FN3O2 and a molecular weight of 239.25 g/mol. Its IUPAC name is N-cyclopropyl-N'-(5-fluoro-2-nitrophenyl)ethane-1,2-diamine.
| Compound Name | N-cyclopropyl-N'-(5-fluoro-2-nitrophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62665396 |
| Molecular Formula | C11H14FN3O2 |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | N-cyclopropyl-N'-(5-fluoro-2-nitrophenyl)ethane-1,2-diamine |
| SMILES | O=[N+]([O-])c1ccc(F)cc1NCCNC1CC1 |
| InChI | InChI=1S/C11H14FN3O2/c12-8-1-4-11(15(16)17)10(7-8)14-6-5-13-9-2-3-9/h1,4,7,9,13-14H,2-3,5-6H2 |
| InChIKey | ATWWQYVNMSAXIG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|