C10H14N4O2 — CID 62663408
N-cyclopropyl-N'-(3-nitro-4-pyridinyl)ethane-1,2-diamine (PubChem CID 62663408) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is N-cyclopropyl-N'-(3-nitro-4-pyridinyl)ethane-1,2-diamine.
| Compound Name | N-cyclopropyl-N'-(3-nitro-4-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62663408 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | N-cyclopropyl-N'-(3-nitro-4-pyridinyl)ethane-1,2-diamine |
| SMILES | O=[N+]([O-])c1cnccc1NCCNC1CC1 |
| InChI | InChI=1S/C10H14N4O2/c15-14(16)10-7-11-4-3-9(10)13-6-5-12-8-1-2-8/h3-4,7-8,12H,1-2,5-6H2,(H,11,13) |
| InChIKey | ZKDHYBUBWNWDMZ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|