C14H23N3O2S — CID 63897640
N-[(1,4-dimethylpiperazin-2-yl)methyl]-4-methylsulfonylaniline (PubChem CID 63897640) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperazin-2-yl)methyl]-4-methylsulfonylaniline.
| Compound Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]-4-methylsulfonylaniline |
|---|---|
| PubChem CID | 63897640 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]-4-methylsulfonylaniline |
| SMILES | CN1CCN(C)C(CNc2ccc(S(C)(=O)=O)cc2)C1 |
| InChI | InChI=1S/C14H23N3O2S/c1-16-8-9-17(2)13(11-16)10-15-12-4-6-14(7-5-12)20(3,18)19/h4-7,13,15H,8-11H2,1-3H3 |
| InChIKey | RKZDWQQRRUCGGN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |