C12H21N5 — CID 63897051
5-N-[(1,4-dimethylpiperazin-2-yl)methyl]pyridine-2,5-diamine (PubChem CID 63897051) has the molecular formula C12H21N5 and a molecular weight of 235.33 g/mol. Its IUPAC name is 5-N-[(1,4-dimethylpiperazin-2-yl)methyl]pyridine-2,5-diamine.
| Compound Name | 5-N-[(1,4-dimethylpiperazin-2-yl)methyl]pyridine-2,5-diamine |
|---|---|
| PubChem CID | 63897051 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 5-N-[(1,4-dimethylpiperazin-2-yl)methyl]pyridine-2,5-diamine |
| SMILES | CN1CCN(C)C(CNc2ccc(N)nc2)C1 |
| InChI | InChI=1S/C12H21N5/c1-16-5-6-17(2)11(9-16)8-14-10-3-4-12(13)15-7-10/h3-4,7,11,14H,5-6,8-9H2,1-2H3,(H2,13,15) |
| InChIKey | YDIGGLPABVOPEK-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |