C15H24N4O2 — CID 63899023
methyl 2-amino-5-[(1,4-dimethylpiperazin-2-yl)methylamino]benzoate (PubChem CID 63899023) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is methyl 2-amino-5-[(1,4-dimethylpiperazin-2-yl)methylamino]benzoate.
| Compound Name | methyl 2-amino-5-[(1,4-dimethylpiperazin-2-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 63899023 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | methyl 2-amino-5-[(1,4-dimethylpiperazin-2-yl)methylamino]benzoate |
| SMILES | COC(=O)c1cc(NCC2CN(C)CCN2C)ccc1N |
| InChI | InChI=1S/C15H24N4O2/c1-18-6-7-19(2)12(10-18)9-17-11-4-5-14(16)13(8-11)15(20)21-3/h4-5,8,12,17H,6-7,9-10,16H2,1-3H3 |
| InChIKey | GIHBYKWQAKTDRH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|