C15H24N4O2 — CID 104782948
4-amino-N-[(1,4-dimethylpiperazin-2-yl)methyl]-3-methoxybenzamide (PubChem CID 104782948) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 4-amino-N-[(1,4-dimethylpiperazin-2-yl)methyl]-3-methoxybenzamide.
| Compound Name | 4-amino-N-[(1,4-dimethylpiperazin-2-yl)methyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 104782948 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 4-amino-N-[(1,4-dimethylpiperazin-2-yl)methyl]-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCC2CN(C)CCN2C)ccc1N |
| InChI | InChI=1S/C15H24N4O2/c1-18-6-7-19(2)12(10-18)9-17-15(20)11-4-5-13(16)14(8-11)21-3/h4-5,8,12H,6-7,9-10,16H2,1-3H3,(H,17,20) |
| InChIKey | MGZHICCTAOWHGO-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|