C14H22N4O — CID 63884571
4-amino-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzamide (PubChem CID 63884571) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 4-amino-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzamide.
| Compound Name | 4-amino-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 63884571 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 4-amino-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzamide |
| SMILES | CN1CCN(C)C(CNC(=O)c2ccc(N)cc2)C1 |
| InChI | InChI=1S/C14H22N4O/c1-17-7-8-18(2)13(10-17)9-16-14(19)11-3-5-12(15)6-4-11/h3-6,13H,7-10,15H2,1-2H3,(H,16,19) |
| InChIKey | YLNNRDCAJLFOOG-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|