C15H24N4O2 — CID 63886501
2-(4-aminophenoxy)-N-[(1,4-dimethylpiperazin-2-yl)methyl]acetamide (PubChem CID 63886501) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-(4-aminophenoxy)-N-[(1,4-dimethylpiperazin-2-yl)methyl]acetamide.
| Compound Name | 2-(4-aminophenoxy)-N-[(1,4-dimethylpiperazin-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 63886501 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2-(4-aminophenoxy)-N-[(1,4-dimethylpiperazin-2-yl)methyl]acetamide |
| SMILES | CN1CCN(C)C(CNC(=O)COc2ccc(N)cc2)C1 |
| InChI | InChI=1S/C15H24N4O2/c1-18-7-8-19(2)13(10-18)9-17-15(20)11-21-14-5-3-12(16)4-6-14/h3-6,13H,7-11,16H2,1-2H3,(H,17,20) |
| InChIKey | LKRUBEPJZTXPMI-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|