C15H22N4OS — CID 63897121
3-carbamothioyl-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzamide (PubChem CID 63897121) has the molecular formula C15H22N4OS and a molecular weight of 306.44 g/mol. Its IUPAC name is 3-carbamothioyl-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzamide.
| Compound Name | 3-carbamothioyl-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 63897121 |
| Molecular Formula | C15H22N4OS |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 3-carbamothioyl-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzamide |
| SMILES | CN1CCN(C)C(CNC(=O)c2cccc(C(N)=S)c2)C1 |
| InChI | InChI=1S/C15H22N4OS/c1-18-6-7-19(2)13(10-18)9-17-15(20)12-5-3-4-11(8-12)14(16)21/h3-5,8,13H,6-7,9-10H2,1-2H3,(H2,16,21)(H,17,20) |
| InChIKey | LBUVDIYJUFMTAB-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|