C14H21ClN4O — CID 63897211
2-amino-5-chloro-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzamide (PubChem CID 63897211) has the molecular formula C14H21ClN4O and a molecular weight of 296.80 g/mol. Its IUPAC name is 2-amino-5-chloro-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzamide.
| Compound Name | 2-amino-5-chloro-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 63897211 |
| Molecular Formula | C14H21ClN4O |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-amino-5-chloro-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzamide |
| SMILES | CN1CCN(C)C(CNC(=O)c2cc(Cl)ccc2N)C1 |
| InChI | InChI=1S/C14H21ClN4O/c1-18-5-6-19(2)11(9-18)8-17-14(20)12-7-10(15)3-4-13(12)16/h3-4,7,11H,5-6,8-9,16H2,1-2H3,(H,17,20) |
| InChIKey | XTMUNOGMRDVXCC-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|