C14H20F2N4O — CID 63884569
2-amino-N-[(1,4-dimethylpiperazin-2-yl)methyl]-4,5-difluorobenzamide (PubChem CID 63884569) has the molecular formula C14H20F2N4O and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-amino-N-[(1,4-dimethylpiperazin-2-yl)methyl]-4,5-difluorobenzamide.
| Compound Name | 2-amino-N-[(1,4-dimethylpiperazin-2-yl)methyl]-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 63884569 |
| Molecular Formula | C14H20F2N4O |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2-amino-N-[(1,4-dimethylpiperazin-2-yl)methyl]-4,5-difluorobenzamide |
| SMILES | CN1CCN(C)C(CNC(=O)c2cc(F)c(F)cc2N)C1 |
| InChI | InChI=1S/C14H20F2N4O/c1-19-3-4-20(2)9(8-19)7-18-14(21)10-5-11(15)12(16)6-13(10)17/h5-6,9H,3-4,7-8,17H2,1-2H3,(H,18,21) |
| InChIKey | HNSCLQPPIZMFDV-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|