C14H23FN4 — CID 103590423
1-N-[(1,4-dimethylpiperazin-2-yl)methyl]-4-fluoro-5-methylbenzene-1,2-diamine (PubChem CID 103590423) has the molecular formula C14H23FN4 and a molecular weight of 266.36 g/mol. Its IUPAC name is 1-N-[(1,4-dimethylpiperazin-2-yl)methyl]-4-fluoro-5-methylbenzene-1,2-diamine.
| Compound Name | 1-N-[(1,4-dimethylpiperazin-2-yl)methyl]-4-fluoro-5-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 103590423 |
| Molecular Formula | C14H23FN4 |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 1-N-[(1,4-dimethylpiperazin-2-yl)methyl]-4-fluoro-5-methylbenzene-1,2-diamine |
| SMILES | Cc1cc(NCC2CN(C)CCN2C)c(N)cc1F |
| InChI | InChI=1S/C14H23FN4/c1-10-6-14(13(16)7-12(10)15)17-8-11-9-18(2)4-5-19(11)3/h6-7,11,17H,4-5,8-9,16H2,1-3H3 |
| InChIKey | ZVHWJIOVEYVRLB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|