C11H17ClN6O2 — CID 63896770
6-chloro-N-[(1,4-dimethylpiperazin-2-yl)methyl]-5-nitropyrimidin-4-amine (PubChem CID 63896770) has the molecular formula C11H17ClN6O2 and a molecular weight of 300.75 g/mol. Its IUPAC name is 6-chloro-N-[(1,4-dimethylpiperazin-2-yl)methyl]-5-nitropyrimidin-4-amine.
| Compound Name | 6-chloro-N-[(1,4-dimethylpiperazin-2-yl)methyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 63896770 |
| Molecular Formula | C11H17ClN6O2 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 6-chloro-N-[(1,4-dimethylpiperazin-2-yl)methyl]-5-nitropyrimidin-4-amine |
| SMILES | CN1CCN(C)C(CNc2ncnc(Cl)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C11H17ClN6O2/c1-16-3-4-17(2)8(6-16)5-13-11-9(18(19)20)10(12)14-7-15-11/h7-8H,3-6H2,1-2H3,(H,13,14,15) |
| InChIKey | JSSUCKOZDJPWQM-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|