C10H13N3O2S2 — CID 113253344
N-(1,4-dithian-2-ylmethyl)-5-nitropyridin-2-amine (PubChem CID 113253344) has the molecular formula C10H13N3O2S2 and a molecular weight of 271.37 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-5-nitropyridin-2-amine.
| Compound Name | N-(1,4-dithian-2-ylmethyl)-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 113253344 |
| Molecular Formula | C10H13N3O2S2 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-5-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(NCC2CSCCS2)nc1 |
| InChI | InChI=1S/C10H13N3O2S2/c14-13(15)8-1-2-10(11-5-8)12-6-9-7-16-3-4-17-9/h1-2,5,9H,3-4,6-7H2,(H,11,12) |
| InChIKey | YDLXCCJNCVXXSW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|