C11H12N4O2S2 — CID 115697143
2-(1,4-dithian-2-ylmethylamino)-3-nitropyridine-4-carbonitrile (PubChem CID 115697143) has the molecular formula C11H12N4O2S2 and a molecular weight of 296.38 g/mol. Its IUPAC name is 2-(1,4-dithian-2-ylmethylamino)-3-nitropyridine-4-carbonitrile.
| Compound Name | 2-(1,4-dithian-2-ylmethylamino)-3-nitropyridine-4-carbonitrile |
|---|---|
| PubChem CID | 115697143 |
| Molecular Formula | C11H12N4O2S2 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 2-(1,4-dithian-2-ylmethylamino)-3-nitropyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(NCC2CSCCS2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12N4O2S2/c12-5-8-1-2-13-11(10(8)15(16)17)14-6-9-7-18-3-4-19-9/h1-2,9H,3-4,6-7H2,(H,13,14) |
| InChIKey | WAMBLRXSXPZUOL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|