C10H10N4O2S — CID 103764758
3-nitro-2-(thiolan-3-ylamino)pyridine-4-carbonitrile (PubChem CID 103764758) has the molecular formula C10H10N4O2S and a molecular weight of 250.28 g/mol. Its IUPAC name is 3-nitro-2-(thiolan-3-ylamino)pyridine-4-carbonitrile.
| Compound Name | 3-nitro-2-(thiolan-3-ylamino)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 103764758 |
| Molecular Formula | C10H10N4O2S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 3-nitro-2-(thiolan-3-ylamino)pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(NC2CCSC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N4O2S/c11-5-7-1-3-12-10(9(7)14(15)16)13-8-2-4-17-6-8/h1,3,8H,2,4,6H2,(H,12,13) |
| InChIKey | FWHPSVMNQDDORP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|