C9H9N5O2 — CID 82812926
2-[(2-aminocyclopropyl)amino]-3-nitropyridine-4-carbonitrile (PubChem CID 82812926) has the molecular formula C9H9N5O2 and a molecular weight of 219.20 g/mol. Its IUPAC name is 2-[(2-aminocyclopropyl)amino]-3-nitropyridine-4-carbonitrile.
| Compound Name | 2-[(2-aminocyclopropyl)amino]-3-nitropyridine-4-carbonitrile |
|---|---|
| PubChem CID | 82812926 |
| Molecular Formula | C9H9N5O2 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 2-[(2-aminocyclopropyl)amino]-3-nitropyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(NC2CC2N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9N5O2/c10-4-5-1-2-12-9(8(5)14(15)16)13-7-3-6(7)11/h1-2,6-7H,3,11H2,(H,12,13) |
| InChIKey | AGRDXQTWBWXDHX-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|