C13H17N5O2 — CID 83025967
2-[(2,6-dimethylpiperidin-1-yl)amino]-3-nitropyridine-4-carbonitrile (PubChem CID 83025967) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-[(2,6-dimethylpiperidin-1-yl)amino]-3-nitropyridine-4-carbonitrile.
| Compound Name | 2-[(2,6-dimethylpiperidin-1-yl)amino]-3-nitropyridine-4-carbonitrile |
|---|---|
| PubChem CID | 83025967 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 2-[(2,6-dimethylpiperidin-1-yl)amino]-3-nitropyridine-4-carbonitrile |
| SMILES | CC1CCCC(C)N1Nc1nccc(C#N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17N5O2/c1-9-4-3-5-10(2)17(9)16-13-12(18(19)20)11(8-14)6-7-15-13/h6-7,9-10H,3-5H2,1-2H3,(H,15,16) |
| InChIKey | NLCNIVMSJCLCKH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 95.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|