C17H16FN5O2 — CID 133411802
2-[[1-(2-fluorophenyl)piperidin-3-yl]amino]-3-nitropyridine-4-carbonitrile (PubChem CID 133411802) has the molecular formula C17H16FN5O2 and a molecular weight of 341.35 g/mol. Its IUPAC name is 2-[[1-(2-fluorophenyl)piperidin-3-yl]amino]-3-nitropyridine-4-carbonitrile.
| Compound Name | 2-[[1-(2-fluorophenyl)piperidin-3-yl]amino]-3-nitropyridine-4-carbonitrile |
|---|---|
| PubChem CID | 133411802 |
| Molecular Formula | C17H16FN5O2 |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 2-[[1-(2-fluorophenyl)piperidin-3-yl]amino]-3-nitropyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(NC2CCCN(c3ccccc3F)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16FN5O2/c18-14-5-1-2-6-15(14)22-9-3-4-13(11-22)21-17-16(23(24)25)12(10-19)7-8-20-17/h1-2,5-8,13H,3-4,9,11H2,(H,20,21) |
| InChIKey | ZZRDBBPZJVSKOT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 95.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|