C17H17FN4 — CID 133411893
6-[[1-(2-fluorophenyl)piperidin-3-yl]amino]pyridine-3-carbonitrile (PubChem CID 133411893) has the molecular formula C17H17FN4 and a molecular weight of 296.35 g/mol. Its IUPAC name is 6-[[1-(2-fluorophenyl)piperidin-3-yl]amino]pyridine-3-carbonitrile.
| Compound Name | 6-[[1-(2-fluorophenyl)piperidin-3-yl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133411893 |
| Molecular Formula | C17H17FN4 |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 6-[[1-(2-fluorophenyl)piperidin-3-yl]amino]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(NC2CCCN(c3ccccc3F)C2)nc1 |
| InChI | InChI=1S/C17H17FN4/c18-15-5-1-2-6-16(15)22-9-3-4-14(12-22)21-17-8-7-13(10-19)11-20-17/h1-2,5-8,11,14H,3-4,9,12H2,(H,20,21) |
| InChIKey | HQSBTGLOVBKDER-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |