C15H14FN5 — CID 171996388
2-fluoro-6-[3-(pyrimidin-4-ylamino)pyrrolidin-1-yl]benzonitrile (PubChem CID 171996388) has the molecular formula C15H14FN5 and a molecular weight of 283.31 g/mol. Its IUPAC name is 2-fluoro-6-[3-(pyrimidin-4-ylamino)pyrrolidin-1-yl]benzonitrile.
| Compound Name | 2-fluoro-6-[3-(pyrimidin-4-ylamino)pyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 171996388 |
| Molecular Formula | C15H14FN5 |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-fluoro-6-[3-(pyrimidin-4-ylamino)pyrrolidin-1-yl]benzonitrile |
| SMILES | N#Cc1c(F)cccc1N1CCC(Nc2ccncn2)C1 |
| InChI | InChI=1S/C15H14FN5/c16-13-2-1-3-14(12(13)8-17)21-7-5-11(9-21)20-15-4-6-18-10-19-15/h1-4,6,10-11H,5,7,9H2,(H,18,19,20) |
| InChIKey | PXOLNOHFARXXBT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |