C17H16F3N5 — CID 172892308
2-[3-[(6-methylpyrimidin-4-yl)amino]pyrrolidin-1-yl]-6-(trifluoromethyl)benzonitrile (PubChem CID 172892308) has the molecular formula C17H16F3N5 and a molecular weight of 347.34 g/mol. Its IUPAC name is 2-[3-[(6-methylpyrimidin-4-yl)amino]pyrrolidin-1-yl]-6-(trifluoromethyl)benzonitrile.
| Compound Name | 2-[3-[(6-methylpyrimidin-4-yl)amino]pyrrolidin-1-yl]-6-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 172892308 |
| Molecular Formula | C17H16F3N5 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 2-[3-[(6-methylpyrimidin-4-yl)amino]pyrrolidin-1-yl]-6-(trifluoromethyl)benzonitrile |
| SMILES | Cc1cc(NC2CCN(c3cccc(C(F)(F)F)c3C#N)C2)ncn1 |
| InChI | InChI=1S/C17H16F3N5/c1-11-7-16(23-10-22-11)24-12-5-6-25(9-12)15-4-2-3-14(13(15)8-21)17(18,19)20/h2-4,7,10,12H,5-6,9H2,1H3,(H,22,23,24) |
| InChIKey | JAWICEPNNLISGW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |