C17H19FN6 — CID 171996840
2-[3-[[6-(dimethylamino)pyrimidin-4-yl]amino]pyrrolidin-1-yl]-3-fluorobenzonitrile (PubChem CID 171996840) has the molecular formula C17H19FN6 and a molecular weight of 326.38 g/mol. Its IUPAC name is 2-[3-[[6-(dimethylamino)pyrimidin-4-yl]amino]pyrrolidin-1-yl]-3-fluorobenzonitrile.
| Compound Name | 2-[3-[[6-(dimethylamino)pyrimidin-4-yl]amino]pyrrolidin-1-yl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 171996840 |
| Molecular Formula | C17H19FN6 |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2-[3-[[6-(dimethylamino)pyrimidin-4-yl]amino]pyrrolidin-1-yl]-3-fluorobenzonitrile |
| SMILES | CN(C)c1cc(NC2CCN(c3c(F)cccc3C#N)C2)ncn1 |
| InChI | InChI=1S/C17H19FN6/c1-23(2)16-8-15(20-11-21-16)22-13-6-7-24(10-13)17-12(9-19)4-3-5-14(17)18/h3-5,8,11,13H,6-7,10H2,1-2H3,(H,20,21,22) |
| InChIKey | NWOLTLMTJPPGND-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 68.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |