C16H16FN5 — CID 94032537
2-fluoro-6-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]amino]benzonitrile (PubChem CID 94032537) has the molecular formula C16H16FN5 and a molecular weight of 297.34 g/mol. Its IUPAC name is 2-fluoro-6-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]amino]benzonitrile.
| Compound Name | 2-fluoro-6-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 94032537 |
| Molecular Formula | C16H16FN5 |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-fluoro-6-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]amino]benzonitrile |
| SMILES | N#Cc1c(F)cccc1N[C@@H]1CCCN(c2ncccn2)C1 |
| InChI | InChI=1S/C16H16FN5/c17-14-5-1-6-15(13(14)10-18)21-12-4-2-9-22(11-12)16-19-7-3-8-20-16/h1,3,5-8,12,21H,2,4,9,11H2/t12-/m1/s1 |
| InChIKey | KQIAXBLNOOXOEV-GFCCVEGCSA-N |
| XLogP | 2.57 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |