C16H16N6O2 — CID 94032540
3-nitro-4-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]amino]benzonitrile (PubChem CID 94032540) has the molecular formula C16H16N6O2 and a molecular weight of 324.34 g/mol. Its IUPAC name is 3-nitro-4-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]amino]benzonitrile.
| Compound Name | 3-nitro-4-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 94032540 |
| Molecular Formula | C16H16N6O2 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 3-nitro-4-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(N[C@@H]2CCCN(c3ncccn3)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H16N6O2/c17-10-12-4-5-14(15(9-12)22(23)24)20-13-3-1-8-21(11-13)16-18-6-2-7-19-16/h2,4-7,9,13,20H,1,3,8,11H2/t13-/m1/s1 |
| InChIKey | NKBVGCGFORTFCG-CYBMUJFWSA-N |
| XLogP | 2.34 |
| TPSA | 107.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|