C17H22N6O2 — CID 56822888
N-[[4-(methylamino)-3-nitrophenyl]methyl]-1-pyrimidin-2-ylpiperidin-3-amine (PubChem CID 56822888) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[[4-(methylamino)-3-nitrophenyl]methyl]-1-pyrimidin-2-ylpiperidin-3-amine.
| Compound Name | N-[[4-(methylamino)-3-nitrophenyl]methyl]-1-pyrimidin-2-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 56822888 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | N-[[4-(methylamino)-3-nitrophenyl]methyl]-1-pyrimidin-2-ylpiperidin-3-amine |
| SMILES | CNc1ccc(CNC2CCCN(c3ncccn3)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H22N6O2/c1-18-15-6-5-13(10-16(15)23(24)25)11-21-14-4-2-9-22(12-14)17-19-7-3-8-20-17/h3,5-8,10,14,18,21H,2,4,9,11-12H2,1H3 |
| InChIKey | JENLHWBHZBHTJC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|