C18H20N4 — CID 42381958
(3S)-N-[(4-ethynylphenyl)methyl]-1-pyrimidin-2-ylpiperidin-3-amine (PubChem CID 42381958) has the molecular formula C18H20N4 and a molecular weight of 292.39 g/mol. Its IUPAC name is (3S)-N-[(4-ethynylphenyl)methyl]-1-pyrimidin-2-ylpiperidin-3-amine.
| Compound Name | (3S)-N-[(4-ethynylphenyl)methyl]-1-pyrimidin-2-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 42381958 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (3S)-N-[(4-ethynylphenyl)methyl]-1-pyrimidin-2-ylpiperidin-3-amine |
| SMILES | C#Cc1ccc(CN[C@H]2CCCN(c3ncccn3)C2)cc1 |
| InChI | InChI=1S/C18H20N4/c1-2-15-6-8-16(9-7-15)13-21-17-5-3-12-22(14-17)18-19-10-4-11-20-18/h1,4,6-11,17,21H,3,5,12-14H2/t17-/m0/s1 |
| InChIKey | YVHGPBYCYXNYHT-KRWDZBQOSA-N |
| XLogP | 2.22 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|