C14H17ClN4O — CID 93318901
(3R)-N-[(5-chlorofuran-2-yl)methyl]-1-pyrimidin-2-ylpiperidin-3-amine (PubChem CID 93318901) has the molecular formula C14H17ClN4O and a molecular weight of 292.77 g/mol. Its IUPAC name is (3R)-N-[(5-chlorofuran-2-yl)methyl]-1-pyrimidin-2-ylpiperidin-3-amine.
| Compound Name | (3R)-N-[(5-chlorofuran-2-yl)methyl]-1-pyrimidin-2-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 93318901 |
| Molecular Formula | C14H17ClN4O |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (3R)-N-[(5-chlorofuran-2-yl)methyl]-1-pyrimidin-2-ylpiperidin-3-amine |
| SMILES | Clc1ccc(CN[C@@H]2CCCN(c3ncccn3)C2)o1 |
| InChI | InChI=1S/C14H17ClN4O/c15-13-5-4-12(20-13)9-18-11-3-1-8-19(10-11)14-16-6-2-7-17-14/h2,4-7,11,18H,1,3,8-10H2/t11-/m1/s1 |
| InChIKey | CXMAOOWECLRZEV-LLVKDONJSA-N |
| XLogP | 2.48 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |