C20H21ClN4O — CID 95575885
(3S)-N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-1-pyrimidin-2-ylpiperidin-3-amine (PubChem CID 95575885) has the molecular formula C20H21ClN4O and a molecular weight of 368.87 g/mol. Its IUPAC name is (3S)-N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-1-pyrimidin-2-ylpiperidin-3-amine.
| Compound Name | (3S)-N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-1-pyrimidin-2-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 95575885 |
| Molecular Formula | C20H21ClN4O |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (3S)-N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-1-pyrimidin-2-ylpiperidin-3-amine |
| SMILES | Clc1ccc(-c2ccc(CN[C@H]3CCCN(c4ncccn4)C3)o2)cc1 |
| InChI | InChI=1S/C20H21ClN4O/c21-16-6-4-15(5-7-16)19-9-8-18(26-19)13-24-17-3-1-12-25(14-17)20-22-10-2-11-23-20/h2,4-11,17,24H,1,3,12-14H2/t17-/m0/s1 |
| InChIKey | WBWBUDVKDGNGGP-KRWDZBQOSA-N |
| XLogP | 4.15 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |