C15H16ClFN4O — CID 133411831
5-chloro-4-[[1-(2-fluorophenyl)piperidin-3-yl]amino]-1H-pyridazin-6-one (PubChem CID 133411831) has the molecular formula C15H16ClFN4O and a molecular weight of 322.77 g/mol. Its IUPAC name is 5-chloro-4-[[1-(2-fluorophenyl)piperidin-3-yl]amino]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-[[1-(2-fluorophenyl)piperidin-3-yl]amino]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 133411831 |
| Molecular Formula | C15H16ClFN4O |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 5-chloro-4-[[1-(2-fluorophenyl)piperidin-3-yl]amino]-1H-pyridazin-6-one |
| SMILES | O=c1[nH]ncc(NC2CCCN(c3ccccc3F)C2)c1Cl |
| InChI | InChI=1S/C15H16ClFN4O/c16-14-12(8-18-20-15(14)22)19-10-4-3-7-21(9-10)13-6-2-1-5-11(13)17/h1-2,5-6,8,10H,3-4,7,9H2,(H2,19,20,22) |
| InChIKey | PYIQAXDFEQAMJJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |