C14H15N3O2S2 — CID 115685336
N-(1,4-dithian-2-ylmethyl)-8-nitroisoquinolin-5-amine (PubChem CID 115685336) has the molecular formula C14H15N3O2S2 and a molecular weight of 321.43 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-8-nitroisoquinolin-5-amine.
| Compound Name | N-(1,4-dithian-2-ylmethyl)-8-nitroisoquinolin-5-amine |
|---|---|
| PubChem CID | 115685336 |
| Molecular Formula | C14H15N3O2S2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-8-nitroisoquinolin-5-amine |
| SMILES | O=[N+]([O-])c1ccc(NCC2CSCCS2)c2ccncc12 |
| InChI | InChI=1S/C14H15N3O2S2/c18-17(19)14-2-1-13(11-3-4-15-8-12(11)14)16-7-10-9-20-5-6-21-10/h1-4,8,10,16H,5-7,9H2 |
| InChIKey | FPXQXYXBSOWHNM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|