C19H17N3O3 — CID 51210488
N-(3,4-dihydro-2H-chromen-3-ylmethyl)-8-nitroisoquinolin-5-amine (PubChem CID 51210488) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-3-ylmethyl)-8-nitroisoquinolin-5-amine.
| Compound Name | N-(3,4-dihydro-2H-chromen-3-ylmethyl)-8-nitroisoquinolin-5-amine |
|---|---|
| PubChem CID | 51210488 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-3-ylmethyl)-8-nitroisoquinolin-5-amine |
| SMILES | O=[N+]([O-])c1ccc(NCC2COc3ccccc3C2)c2ccncc12 |
| InChI | InChI=1S/C19H17N3O3/c23-22(24)18-6-5-17(15-7-8-20-11-16(15)18)21-10-13-9-14-3-1-2-4-19(14)25-12-13/h1-8,11,13,21H,9-10,12H2 |
| InChIKey | BCOWQPSAFCCWDQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|