C11H14FNO2S3 — CID 115685195
N-(1,4-dithian-2-ylmethyl)-2-fluorobenzenesulfonamide (PubChem CID 115685195) has the molecular formula C11H14FNO2S3 and a molecular weight of 307.44 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-2-fluorobenzenesulfonamide.
| Compound Name | N-(1,4-dithian-2-ylmethyl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 115685195 |
| Molecular Formula | C11H14FNO2S3 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-2-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCC1CSCCS1)c1ccccc1F |
| InChI | InChI=1S/C11H14FNO2S3/c12-10-3-1-2-4-11(10)18(14,15)13-7-9-8-16-5-6-17-9/h1-4,9,13H,5-8H2 |
| InChIKey | WRWOSNDPDKJAJW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |