C12H13ClN2O2S3 — CID 103989835
2-chloro-4-cyano-N-(1,4-dithian-2-ylmethyl)benzenesulfonamide (PubChem CID 103989835) has the molecular formula C12H13ClN2O2S3 and a molecular weight of 348.90 g/mol. Its IUPAC name is 2-chloro-4-cyano-N-(1,4-dithian-2-ylmethyl)benzenesulfonamide.
| Compound Name | 2-chloro-4-cyano-N-(1,4-dithian-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103989835 |
| Molecular Formula | C12H13ClN2O2S3 |
| Molecular Weight | 348.90 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | 2-chloro-4-cyano-N-(1,4-dithian-2-ylmethyl)benzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCC2CSCCS2)c(Cl)c1 |
| InChI | InChI=1S/C12H13ClN2O2S3/c13-11-5-9(6-14)1-2-12(11)20(16,17)15-7-10-8-18-3-4-19-10/h1-2,5,10,15H,3-4,7-8H2 |
| InChIKey | DSOWICOIIAQGGA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.90 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |