C12H15ClN2O2S — CID 103989185
2-chloro-4-cyano-N-(2,2-dimethylpropyl)benzenesulfonamide (PubChem CID 103989185) has the molecular formula C12H15ClN2O2S and a molecular weight of 286.78 g/mol. Its IUPAC name is 2-chloro-4-cyano-N-(2,2-dimethylpropyl)benzenesulfonamide.
| Compound Name | 2-chloro-4-cyano-N-(2,2-dimethylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103989185 |
| Molecular Formula | C12H15ClN2O2S |
| Molecular Weight | 286.78 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 2-chloro-4-cyano-N-(2,2-dimethylpropyl)benzenesulfonamide |
| SMILES | CC(C)(C)CNS(=O)(=O)c1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C12H15ClN2O2S/c1-12(2,3)8-15-18(16,17)11-5-4-9(7-14)6-10(11)13/h4-6,15H,8H2,1-3H3 |
| InChIKey | ITNDQINFWALOIR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.78 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |