C11H9ClN2O2S — CID 114419165
N-but-3-yn-2-yl-2-chloro-4-cyanobenzenesulfonamide (PubChem CID 114419165) has the molecular formula C11H9ClN2O2S and a molecular weight of 268.72 g/mol. Its IUPAC name is N-but-3-yn-2-yl-2-chloro-4-cyanobenzenesulfonamide.
| Compound Name | N-but-3-yn-2-yl-2-chloro-4-cyanobenzenesulfonamide |
|---|---|
| PubChem CID | 114419165 |
| Molecular Formula | C11H9ClN2O2S |
| Molecular Weight | 268.72 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | N-but-3-yn-2-yl-2-chloro-4-cyanobenzenesulfonamide |
| SMILES | C#CC(C)NS(=O)(=O)c1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C11H9ClN2O2S/c1-3-8(2)14-17(15,16)11-5-4-9(7-13)6-10(11)12/h1,4-6,8,14H,2H3 |
| InChIKey | JPCNWSLYZAFVJP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.72 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|