C16H20N4O3S — CID 136575063
N-[3-[2-(but-3-yn-2-ylsulfamoyl)-5-cyanoanilino]propyl]acetamide (PubChem CID 136575063) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is N-[3-[2-(but-3-yn-2-ylsulfamoyl)-5-cyanoanilino]propyl]acetamide.
| Compound Name | N-[3-[2-(but-3-yn-2-ylsulfamoyl)-5-cyanoanilino]propyl]acetamide |
|---|---|
| PubChem CID | 136575063 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | N-[3-[2-(but-3-yn-2-ylsulfamoyl)-5-cyanoanilino]propyl]acetamide |
| SMILES | C#CC(C)NS(=O)(=O)c1ccc(C#N)cc1NCCCNC(C)=O |
| InChI | InChI=1S/C16H20N4O3S/c1-4-12(2)20-24(22,23)16-7-6-14(11-17)10-15(16)19-9-5-8-18-13(3)21/h1,6-7,10,12,19-20H,5,8-9H2,2-3H3,(H,18,21) |
| InChIKey | IAXFTGYJJFWOIA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 111.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|