C10H13N5O — CID 104712227
2-(2-amino-5-cyanoanilino)ethylurea (PubChem CID 104712227) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is 2-(2-amino-5-cyanoanilino)ethylurea.
| Compound Name | 2-(2-amino-5-cyanoanilino)ethylurea |
|---|---|
| PubChem CID | 104712227 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 2-(2-amino-5-cyanoanilino)ethylurea |
| SMILES | N#Cc1ccc(N)c(NCCNC(N)=O)c1 |
| InChI | InChI=1S/C10H13N5O/c11-6-7-1-2-8(12)9(5-7)14-3-4-15-10(13)16/h1-2,5,14H,3-4,12H2,(H3,13,15,16) |
| InChIKey | SBQLKTXQQSRRJH-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 116.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|