C15H20N4O4 — CID 90220259
(2S)-2-amino-2-[(2-amino-5-cyanoanilino)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid (PubChem CID 90220259) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is (2S)-2-amino-2-[(2-amino-5-cyanoanilino)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid.
| Compound Name | (2S)-2-amino-2-[(2-amino-5-cyanoanilino)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 90220259 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (2S)-2-amino-2-[(2-amino-5-cyanoanilino)methyl]-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid |
| SMILES | CC(C)(C)OC(=O)[C@](N)(CNc1cc(C#N)ccc1N)C(=O)O |
| InChI | InChI=1S/C15H20N4O4/c1-14(2,3)23-13(22)15(18,12(20)21)8-19-11-6-9(7-16)4-5-10(11)17/h4-6,19H,8,17-18H2,1-3H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | VUDABISOKRPXMF-HNNXBMFYSA-N |
| XLogP | 0.68 |
| TPSA | 151.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|