C13H17F3N2O2 — CID 176905565
tert-butyl 4-amino-3-(2,2,2-trifluoroethylamino)benzoate (PubChem CID 176905565) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.29 g/mol. Its IUPAC name is tert-butyl 4-amino-3-(2,2,2-trifluoroethylamino)benzoate.
| Compound Name | tert-butyl 4-amino-3-(2,2,2-trifluoroethylamino)benzoate |
|---|---|
| PubChem CID | 176905565 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | tert-butyl 4-amino-3-(2,2,2-trifluoroethylamino)benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(N)c(NCC(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F3N2O2/c1-12(2,3)20-11(19)8-4-5-9(17)10(6-8)18-7-13(14,15)16/h4-6,18H,7,17H2,1-3H3 |
| InChIKey | TVBZAJLNIXGQRB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|