C10H9Cl2NO2S — CID 114419120
N-but-3-yn-2-yl-2,5-dichlorobenzenesulfonamide (PubChem CID 114419120) has the molecular formula C10H9Cl2NO2S and a molecular weight of 278.16 g/mol. Its IUPAC name is N-but-3-yn-2-yl-2,5-dichlorobenzenesulfonamide.
| Compound Name | N-but-3-yn-2-yl-2,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 114419120 |
| Molecular Formula | C10H9Cl2NO2S |
| Molecular Weight | 278.16 g/mol |
| Exact Mass | 276.97 |
| IUPAC Name | N-but-3-yn-2-yl-2,5-dichlorobenzenesulfonamide |
| SMILES | C#CC(C)NS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H9Cl2NO2S/c1-3-7(2)13-16(14,15)10-6-8(11)4-5-9(10)12/h1,4-7,13H,2H3 |
| InChIKey | GTYMBNMJCWFHSV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.16 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|