C17H19Cl2NO2S — CID 22201161
2,5-dichloro-N-[1-(4-propan-2-ylphenyl)ethyl]benzenesulfonamide (PubChem CID 22201161) has the molecular formula C17H19Cl2NO2S and a molecular weight of 372.32 g/mol. Its IUPAC name is 2,5-dichloro-N-[1-(4-propan-2-ylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[1-(4-propan-2-ylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22201161 |
| Molecular Formula | C17H19Cl2NO2S |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 2,5-dichloro-N-[1-(4-propan-2-ylphenyl)ethyl]benzenesulfonamide |
| SMILES | CC(C)c1ccc(C(C)NS(=O)(=O)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H19Cl2NO2S/c1-11(2)13-4-6-14(7-5-13)12(3)20-23(21,22)17-10-15(18)8-9-16(17)19/h4-12,20H,1-3H3 |
| InChIKey | IPZBOTPXNFGXLE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |